C45H20F10N4O — CID 136818617
10-[4-(1-benzofuran-2-yl)phenyl]-5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin (PubChem CID 136818617) has the molecular formula C45H20F10N4O and a molecular weight of 822.66 g/mol. Its IUPAC name is 10-[4-(1-benzofuran-2-yl)phenyl]-5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 10-[4-(1-benzofuran-2-yl)phenyl]-5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 136818617 |
| Molecular Formula | C45H20F10N4O |
| Molecular Weight | 822.66 g/mol |
| Exact Mass | 822.15 |
| IUPAC Name | 10-[4-(1-benzofuran-2-yl)phenyl]-5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,23-dihydro-21H-corrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4ccc(-c5cc6ccccc6o5)cc4)c4ccc2[nH]4)C=C3)c(F)c1F |
| InChI | InChI=1S/C45H20F10N4O/c46-36-34(37(47)41(51)44(54)40(36)50)32-25-11-9-21(56-25)22-10-12-26(57-22)33(35-38(48)42(52)45(55)43(53)39(35)49)28-16-14-24(59-28)31(23-13-15-27(32)58-23)19-7-5-18(6-8-19)30-17-20-3-1-2-4-29(20)60-30/h1-17,56,58-59H/b22-21-,31-23-,31-24-,32-25+,32-27+,33-26+,33-28+ |
| InChIKey | RNHCLRFFYLGKSW-VOLKZREISA-N |
| XLogP | 13.50 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.66 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|