C37H17F9N4 — CID 136825566
5,10,15-tris(3,4,5-trifluorophenyl)-22,23-dihydro-21H-corrin (PubChem CID 136825566) has the molecular formula C37H17F9N4 and a molecular weight of 688.55 g/mol. Its IUPAC name is 5,10,15-tris(3,4,5-trifluorophenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(3,4,5-trifluorophenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 136825566 |
| Molecular Formula | C37H17F9N4 |
| Molecular Weight | 688.55 g/mol |
| Exact Mass | 688.13 |
| IUPAC Name | 5,10,15-tris(3,4,5-trifluorophenyl)-22,23-dihydro-21H-corrin |
| SMILES | Fc1cc(-c2c3nc(c4ccc([nH]4)c(-c4cc(F)c(F)c(F)c4)c4ccc([nH]4)c(-c4cc(F)c(F)c(F)c4)c4ccc2[nH]4)C=C3)cc(F)c1F |
| InChI | InChI=1S/C37H17F9N4/c38-18-9-15(10-19(39)35(18)44)32-26-3-1-24(47-26)25-2-4-27(48-25)33(16-11-20(40)36(45)21(41)12-16)29-6-8-31(50-29)34(30-7-5-28(32)49-30)17-13-22(42)37(46)23(43)14-17/h1-14,47,49-50H/b25-24-,32-26-,32-28-,33-27-,33-29-,34-30-,34-31- |
| InChIKey | MDQQVNABNRXSDK-ORFJJSTCSA-N |
| XLogP | 10.95 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.55 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|