C37H26N4O6 — CID 136714961
5-[10,15-bis(3,5-dihydroxyphenyl)-23,24-dihydro-22H-corrin-5-yl]benzene-1,3-diol (PubChem CID 136714961) has the molecular formula C37H26N4O6 and a molecular weight of 622.64 g/mol. Its IUPAC name is 5-[10,15-bis(3,5-dihydroxyphenyl)-23,24-dihydro-22H-corrin-5-yl]benzene-1,3-diol.
| Compound Name | 5-[10,15-bis(3,5-dihydroxyphenyl)-23,24-dihydro-22H-corrin-5-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136714961 |
| Molecular Formula | C37H26N4O6 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | 5-[10,15-bis(3,5-dihydroxyphenyl)-23,24-dihydro-22H-corrin-5-yl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(-c2c3nc(c4ccc([nH]4)c(-c4cc(O)cc(O)c4)c4ccc([nH]4)c(-c4cc(O)cc(O)c4)c4ccc2[nH]4)C=C3)c1 |
| InChI | InChI=1S/C37H26N4O6/c42-21-9-18(10-22(43)15-21)35-29-3-1-27(38-29)28-2-4-30(39-28)36(19-11-23(44)16-24(45)12-19)32-6-8-34(41-32)37(33-7-5-31(35)40-33)20-13-25(46)17-26(47)14-20/h1-17,38,40-47H/b28-27-,35-29-,35-31-,36-30-,36-32-,37-33-,37-34- |
| InChIKey | ZITUXAPGKCCJHB-BXDIYPIMSA-N |
| XLogP | 7.93 |
| TPSA | 181.64 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |