C44H26F4FeN4 — CID 174785933
iron;5,10,15,20-tetrakis(4-fluorophenyl)-21,23-dihydroporphyrin (PubChem CID 174785933) has the molecular formula C44H26F4FeN4 and a molecular weight of 742.56 g/mol. Its IUPAC name is iron;5,10,15,20-tetrakis(4-fluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | iron;5,10,15,20-tetrakis(4-fluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 174785933 |
| Molecular Formula | C44H26F4FeN4 |
| Molecular Weight | 742.56 g/mol |
| Exact Mass | 742.14 |
| IUPAC Name | iron;5,10,15,20-tetrakis(4-fluorophenyl)-21,23-dihydroporphyrin |
| SMILES | Fc1ccc(-c2c3nc(c(-c4ccc(F)cc4)c4ccc([nH]4)c(-c4ccc(F)cc4)c4nc(c(-c5ccc(F)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1.[Fe] |
| InChI | InChI=1S/C44H26F4N4.Fe/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27;/h1-24,49,52H;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | AESROAOOYJECCD-DAJBKUBHSA-N |
| XLogP | 11.88 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.56 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|