C44H22F8N4O4 — CID 135469238
2,6-difluoro-4-[10,15,20-tris(3,5-difluoro-4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 135469238) has the molecular formula C44H22F8N4O4 and a molecular weight of 822.67 g/mol. Its IUPAC name is 2,6-difluoro-4-[10,15,20-tris(3,5-difluoro-4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 2,6-difluoro-4-[10,15,20-tris(3,5-difluoro-4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 135469238 |
| Molecular Formula | C44H22F8N4O4 |
| Molecular Weight | 822.67 g/mol |
| Exact Mass | 822.15 |
| IUPAC Name | 2,6-difluoro-4-[10,15,20-tris(3,5-difluoro-4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | Oc1c(F)cc(-c2c3nc(c(-c4cc(F)c(O)c(F)c4)c4ccc([nH]4)c(-c4cc(F)c(O)c(F)c4)c4nc(c(-c5cc(F)c(O)c(F)c5)c5ccc2[nH]5)C=C4)C=C3)cc1F |
| InChI | InChI=1S/C44H22F8N4O4/c45-21-9-17(10-22(46)41(21)57)37-29-1-2-30(53-29)38(18-11-23(47)42(58)24(48)12-18)32-5-6-34(55-32)40(20-15-27(51)44(60)28(52)16-20)36-8-7-35(56-36)39(33-4-3-31(37)54-33)19-13-25(49)43(59)26(50)14-19/h1-16,53,56-60H/b37-29-,37-31-,38-30-,38-32-,39-33-,39-35-,40-34-,40-36- |
| InChIKey | WXUZCELUUUXFHM-XXDGMDECSA-N |
| XLogP | 11.26 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.67 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |