C44H22Cl8CuN4 — CID 174944569
copper;5,10,15,20-tetrakis(3,5-dichlorophenyl)-21,23-dihydroporphyrin (PubChem CID 174944569) has the molecular formula C44H22Cl8CuN4 and a molecular weight of 953.86 g/mol. Its IUPAC name is copper;5,10,15,20-tetrakis(3,5-dichlorophenyl)-21,23-dihydroporphyrin.
| Compound Name | copper;5,10,15,20-tetrakis(3,5-dichlorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 174944569 |
| Molecular Formula | C44H22Cl8CuN4 |
| Molecular Weight | 953.86 g/mol |
| Exact Mass | 948.86 |
| IUPAC Name | copper;5,10,15,20-tetrakis(3,5-dichlorophenyl)-21,23-dihydroporphyrin |
| SMILES | Clc1cc(Cl)cc(-c2c3nc(c(-c4cc(Cl)cc(Cl)c4)c4ccc([nH]4)c(-c4cc(Cl)cc(Cl)c4)c4nc(c(-c5cc(Cl)cc(Cl)c5)c5ccc2[nH]5)C=C4)C=C3)c1.[Cu] |
| InChI | InChI=1S/C44H22Cl8N4.Cu/c45-25-9-21(10-26(46)17-25)41-33-1-2-34(53-33)42(22-11-27(47)18-28(48)12-22)36-5-6-38(55-36)44(24-15-31(51)20-32(52)16-24)40-8-7-39(56-40)43(37-4-3-35(41)54-37)23-13-29(49)19-30(50)14-23;/h1-20,53,56H;/b41-33-,41-35-,42-34-,42-36-,43-37-,43-39-,44-38-,44-40-; |
| InChIKey | DLKLIDQUIMYTHZ-CTPWHPEQSA-N |
| XLogP | 16.55 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.86 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |