C44H27Cl3CuN4O — CID 175008074
copper;4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 175008074) has the molecular formula C44H27Cl3CuN4O and a molecular weight of 797.63 g/mol. Its IUPAC name is copper;4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | copper;4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 175008074 |
| Molecular Formula | C44H27Cl3CuN4O |
| Molecular Weight | 797.63 g/mol |
| Exact Mass | 795.05 |
| IUPAC Name | copper;4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | Oc1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4ccc([nH]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccc(Cl)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1.[Cu] |
| InChI | InChI=1S/C44H27Cl3N4O.Cu/c45-29-9-1-25(2-10-29)41-33-17-19-35(48-33)42(26-3-11-30(46)12-4-26)37-21-23-39(50-37)44(28-7-15-32(52)16-8-28)40-24-22-38(51-40)43(36-20-18-34(41)49-36)27-5-13-31(47)14-6-27;/h1-24,48,51-52H;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | DZVHTSSAODEXQE-DAJBKUBHSA-N |
| XLogP | 12.99 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.63 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |