C47H29Cl3N4O2 — CID 136803781
[4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] prop-2-enoate (PubChem CID 136803781) has the molecular formula C47H29Cl3N4O2 and a molecular weight of 788.13 g/mol. Its IUPAC name is [4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] prop-2-enoate.
| Compound Name | [4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 136803781 |
| Molecular Formula | C47H29Cl3N4O2 |
| Molecular Weight | 788.13 g/mol |
| Exact Mass | 786.14 |
| IUPAC Name | [4-[10,15,20-tris(4-chlorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2c3nc(c(-c4ccc(Cl)cc4)c4ccc([nH]4)c(-c4ccc(Cl)cc4)c4nc(c(-c5ccc(Cl)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H29Cl3N4O2/c1-2-43(55)56-34-17-9-30(10-18-34)47-41-25-23-39(53-41)45(28-5-13-32(49)14-6-28)37-21-19-35(51-37)44(27-3-11-31(48)12-4-27)36-20-22-38(52-36)46(40-24-26-42(47)54-40)29-7-15-33(50)16-8-29/h2-26,51,54H,1H2/b44-35-,44-36-,45-37-,45-39-,46-38-,46-40-,47-41-,47-42- |
| InChIKey | CNILZBZMWHLHBB-PKUICKBVSA-N |
| XLogP | 13.38 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.13 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|