C56H42N4O6 — CID 136908134
[4-[10,15-bis[4-(2-methylprop-2-enoyloxy)phenyl]-20-phenyl-21,23-dihydroporphyrin-5-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 136908134) has the molecular formula C56H42N4O6 and a molecular weight of 866.97 g/mol. Its IUPAC name is [4-[10,15-bis[4-(2-methylprop-2-enoyloxy)phenyl]-20-phenyl-21,23-dihydroporphyrin-5-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[10,15-bis[4-(2-methylprop-2-enoyloxy)phenyl]-20-phenyl-21,23-dihydroporphyrin-5-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 136908134 |
| Molecular Formula | C56H42N4O6 |
| Molecular Weight | 866.97 g/mol |
| Exact Mass | 866.31 |
| IUPAC Name | [4-[10,15-bis[4-(2-methylprop-2-enoyloxy)phenyl]-20-phenyl-21,23-dihydroporphyrin-5-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2c3nc(c(-c4ccc(OC(=O)C(=C)C)cc4)c4ccc([nH]4)c(-c4ccc(OC(=O)C(=C)C)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C56H42N4O6/c1-32(2)54(61)64-39-18-12-36(13-19-39)51-44-26-24-42(57-44)50(35-10-8-7-9-11-35)43-25-27-45(58-43)52(37-14-20-40(21-15-37)65-55(62)33(3)4)47-29-31-49(60-47)53(48-30-28-46(51)59-48)38-16-22-41(23-17-38)66-56(63)34(5)6/h7-31,57,60H,1,3,5H2,2,4,6H3/b50-42-,50-43-,51-44-,51-46-,52-45-,52-47-,53-48-,53-49- |
| InChIKey | SSSYJSRAEVDDOL-APYASCQISA-N |
| XLogP | 12.77 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.97 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|