C47H34N4O — CID 136732211
5,10,15-triphenyl-20-(4-prop-2-enoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 136732211) has the molecular formula C47H34N4O and a molecular weight of 670.82 g/mol. Its IUPAC name is 5,10,15-triphenyl-20-(4-prop-2-enoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-triphenyl-20-(4-prop-2-enoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136732211 |
| Molecular Formula | C47H34N4O |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | 5,10,15-triphenyl-20-(4-prop-2-enoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | C=CCOc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H34N4O/c1-2-30-52-35-20-18-34(19-21-35)47-42-28-26-40(50-42)45(32-14-8-4-9-15-32)38-24-22-36(48-38)44(31-12-6-3-7-13-31)37-23-25-39(49-37)46(33-16-10-5-11-17-33)41-27-29-43(47)51-41/h2-29,48,51H,1,30H2/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43- |
| InChIKey | WWQKQIZLTYNGFX-ZQANTMHOSA-N |
| XLogP | 11.89 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|