C48H38N4O3 — CID 137254418
2-[2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]ethoxy]ethanol (PubChem CID 137254418) has the molecular formula C48H38N4O3 and a molecular weight of 718.86 g/mol. Its IUPAC name is 2-[2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 137254418 |
| Molecular Formula | C48H38N4O3 |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.29 |
| IUPAC Name | 2-[2-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenoxy]ethoxy]ethanol |
| SMILES | OCCOCCOc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H38N4O3/c53-28-29-54-30-31-55-36-18-16-35(17-19-36)48-43-26-24-41(51-43)46(33-12-6-2-7-13-33)39-22-20-37(49-39)45(32-10-4-1-5-11-32)38-21-23-40(50-38)47(34-14-8-3-9-15-34)42-25-27-44(48)52-42/h1-27,49,52-53H,28-31H2/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | XVGZVYIDPFRVNU-PJEPRTEXSA-N |
| XLogP | 10.71 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|