C68H78N4O3 — CID 136819984
5,10,15-tris(4-octoxyphenyl)-20-phenyl-21,23-dihydroporphyrin (PubChem CID 136819984) has the molecular formula C68H78N4O3 and a molecular weight of 999.40 g/mol. Its IUPAC name is 5,10,15-tris(4-octoxyphenyl)-20-phenyl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(4-octoxyphenyl)-20-phenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136819984 |
| Molecular Formula | C68H78N4O3 |
| Molecular Weight | 999.40 g/mol |
| Exact Mass | 998.61 |
| IUPAC Name | 5,10,15-tris(4-octoxyphenyl)-20-phenyl-21,23-dihydroporphyrin |
| SMILES | CCCCCCCCOc1ccc(-c2c3nc(c(-c4ccc(OCCCCCCCC)cc4)c4ccc([nH]4)c(-c4ccc(OCCCCCCCC)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C68H78N4O3/c1-4-7-10-13-16-22-47-73-54-33-27-51(28-34-54)66-59-41-39-57(69-59)65(50-25-20-19-21-26-50)58-40-42-60(70-58)67(52-29-35-55(36-30-52)74-48-23-17-14-11-8-5-2)62-44-46-64(72-62)68(63-45-43-61(66)71-63)53-31-37-56(38-32-53)75-49-24-18-15-12-9-6-3/h19-21,25-46,69,72H,4-18,22-24,47-49H2,1-3H3/b65-57-,65-58-,66-59-,66-61-,67-60-,67-62-,68-63-,68-64- |
| InChIKey | OECLWXQWMOBBGI-ZOUHOBQGSA-N |
| XLogP | 19.54 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.40 |
| LogP ≤ 5 | 19.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|