C92H126N4O6 — CID 136690948
5,10,15-tris(3,5-dioctoxyphenyl)-20-phenyl-21,23-dihydroporphyrin (PubChem CID 136690948) has the molecular formula C92H126N4O6 and a molecular weight of 1384.04 g/mol. Its IUPAC name is 5,10,15-tris(3,5-dioctoxyphenyl)-20-phenyl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-tris(3,5-dioctoxyphenyl)-20-phenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136690948 |
| Molecular Formula | C92H126N4O6 |
| Molecular Weight | 1384.04 g/mol |
| Exact Mass | 1382.97 |
| IUPAC Name | 5,10,15-tris(3,5-dioctoxyphenyl)-20-phenyl-21,23-dihydroporphyrin |
| SMILES | CCCCCCCCOc1cc(OCCCCCCCC)cc(-c2c3nc(c(-c4cc(OCCCCCCCC)cc(OCCCCCCCC)c4)c4ccc([nH]4)c(-c4cc(OCCCCCCCC)cc(OCCCCCCCC)c4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C92H126N4O6/c1-7-13-19-25-31-40-56-97-75-62-72(63-76(68-75)98-57-41-32-26-20-14-8-2)90-83-50-48-81(93-83)89(71-46-38-37-39-47-71)82-49-51-84(94-82)91(73-64-77(99-58-42-33-27-21-15-9-3)69-78(65-73)100-59-43-34-28-22-16-10-4)86-53-55-88(96-86)92(87-54-52-85(90)95-87)74-66-79(101-60-44-35-29-23-17-11-5)70-80(67-74)102-61-45-36-30-24-18-12-6/h37-39,46-55,62-70,93,96H,7-36,40-45,56-61H2,1-6H3/b89-81-,89-82-,90-83-,90-85-,91-84-,91-86-,92-87-,92-88- |
| InChIKey | OMTLJHXEKYEVRT-FNNPUSOKSA-N |
| XLogP | 27.76 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 102 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1384.04 |
| LogP ≤ 5 | 27.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|