C76H94N4O4 — CID 11228608
5,10,15,20-tetrakis(4-octoxyphenyl)-21,22-dihydroporphyrin (PubChem CID 11228608) has the molecular formula C76H94N4O4 and a molecular weight of 1127.61 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-octoxyphenyl)-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-octoxyphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11228608 |
| Molecular Formula | C76H94N4O4 |
| Molecular Weight | 1127.61 g/mol |
| Exact Mass | 1126.73 |
| IUPAC Name | 5,10,15,20-tetrakis(4-octoxyphenyl)-21,22-dihydroporphyrin |
| SMILES | CCCCCCCCOc1ccc(-c2c3nc(c(-c4ccc(OCCCCCCCC)cc4)c4ccc([nH]4)c(-c4ccc(OCCCCCCCC)cc4)c4ccc([nH]4)c(-c4ccc(OCCCCCCCC)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C76H94N4O4/c1-5-9-13-17-21-25-53-81-61-37-29-57(30-38-61)73-65-45-47-67(77-65)74(58-31-39-62(40-32-58)82-54-26-22-18-14-10-6-2)69-49-51-71(79-69)76(60-35-43-64(44-36-60)84-56-28-24-20-16-12-8-4)72-52-50-70(80-72)75(68-48-46-66(73)78-68)59-33-41-63(42-34-59)83-55-27-23-19-15-11-7-3/h29-52,77-78H,5-28,53-56H2,1-4H3/b73-65-,73-66-,74-67-,74-69-,75-68-,75-70-,76-71-,76-72- |
| InChIKey | YQNWELGRDCGRDA-HTTNFVRMSA-N |
| XLogP | 22.28 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1127.61 |
| LogP ≤ 5 | 22.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|