C64H84I2N4O4 — CID 11083733
5,15-bis(3,5-dioctoxyphenyl)-10,20-diiodo-21,22-dihydroporphyrin (PubChem CID 11083733) has the molecular formula C64H84I2N4O4 and a molecular weight of 1227.21 g/mol. Its IUPAC name is 5,15-bis(3,5-dioctoxyphenyl)-10,20-diiodo-21,22-dihydroporphyrin.
| Compound Name | 5,15-bis(3,5-dioctoxyphenyl)-10,20-diiodo-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11083733 |
| Molecular Formula | C64H84I2N4O4 |
| Molecular Weight | 1227.21 g/mol |
| Exact Mass | 1226.46 |
| IUPAC Name | 5,15-bis(3,5-dioctoxyphenyl)-10,20-diiodo-21,22-dihydroporphyrin |
| SMILES | CCCCCCCCOc1cc(OCCCCCCCC)cc(-c2c3nc(c(I)c4ccc([nH]4)c(-c4cc(OCCCCCCCC)cc(OCCCCCCCC)c4)c4ccc([nH]4)c(I)c4nc2C=C4)C=C3)c1 |
| InChI | InChI=1S/C64H84I2N4O4/c1-5-9-13-17-21-25-37-71-49-41-47(42-50(45-49)72-38-26-22-18-14-10-6-2)61-53-29-33-57(67-53)63(65)59-35-31-55(69-59)62(56-32-36-60(70-56)64(66)58-34-30-54(61)68-58)48-43-51(73-39-27-23-19-15-11-7-3)46-52(44-48)74-40-28-24-20-16-12-8-4/h29-36,41-46,67-68H,5-28,37-40H2,1-4H3/b61-53-,61-54-,62-55-,62-56-,63-57+,63-59+,64-58+,64-60+ |
| InChIKey | AADMEYJBJPVLKF-HZPGTIQNSA-N |
| XLogP | 20.16 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1227.21 |
| LogP ≤ 5 | 20.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|