C88H110N4O4 — CID 136746054
5,15-bis[2-(4-butylphenyl)ethynyl]-10,20-bis(3,5-dioctoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 136746054) has the molecular formula C88H110N4O4 and a molecular weight of 1287.87 g/mol. Its IUPAC name is 5,15-bis[2-(4-butylphenyl)ethynyl]-10,20-bis(3,5-dioctoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis[2-(4-butylphenyl)ethynyl]-10,20-bis(3,5-dioctoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136746054 |
| Molecular Formula | C88H110N4O4 |
| Molecular Weight | 1287.87 g/mol |
| Exact Mass | 1286.85 |
| IUPAC Name | 5,15-bis[2-(4-butylphenyl)ethynyl]-10,20-bis(3,5-dioctoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | CCCCCCCCOc1cc(OCCCCCCCC)cc(-c2c3nc(c(C#Cc4ccc(CCCC)cc4)c4ccc([nH]4)c(-c4cc(OCCCCCCCC)cc(OCCCCCCCC)c4)c4nc(c(C#Cc5ccc(CCCC)cc5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C88H110N4O4/c1-7-13-19-23-27-31-57-93-73-61-71(62-74(65-73)94-58-32-28-24-20-14-8-2)87-83-53-49-79(89-83)77(47-45-69-41-37-67(38-42-69)35-17-11-5)81-51-55-85(91-81)88(72-63-75(95-59-33-29-25-21-15-9-3)66-76(64-72)96-60-34-30-26-22-16-10-4)86-56-52-82(92-86)78(80-50-54-84(87)90-80)48-46-70-43-39-68(40-44-70)36-18-12-6/h37-44,49-56,61-66,89,92H,7-36,57-60H2,1-6H3/b79-77-,80-78-,81-77-,82-78-,87-83-,87-84-,88-85-,88-86- |
| InChIKey | MNWZNNUKQZIHPE-KFVJVQEPSA-N |
| XLogP | 24.43 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1287.87 |
| LogP ≤ 5 | 24.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|