C69H67N5O2 — CID 137274549
4-[2-[10,20-bis(3,5-dimethylphenyl)-15-(4-hexyl-N-(4-hexylphenyl)anilino)-21,23-dihydroporphyrin-5-yl]ethynyl]benzoic acid (PubChem CID 137274549) has the molecular formula C69H67N5O2 and a molecular weight of 998.33 g/mol. Its IUPAC name is 4-[2-[10,20-bis(3,5-dimethylphenyl)-15-(4-hexyl-N-(4-hexylphenyl)anilino)-21,23-dihydroporphyrin-5-yl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[10,20-bis(3,5-dimethylphenyl)-15-(4-hexyl-N-(4-hexylphenyl)anilino)-21,23-dihydroporphyrin-5-yl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 137274549 |
| Molecular Formula | C69H67N5O2 |
| Molecular Weight | 998.33 g/mol |
| Exact Mass | 997.53 |
| IUPAC Name | 4-[2-[10,20-bis(3,5-dimethylphenyl)-15-(4-hexyl-N-(4-hexylphenyl)anilino)-21,23-dihydroporphyrin-5-yl]ethynyl]benzoic acid |
| SMILES | CCCCCCc1ccc(N(c2ccc(CCCCCC)cc2)c2c3nc(c(-c4cc(C)cc(C)c4)c4ccc([nH]4)c(C#Cc4ccc(C(=O)O)cc4)c4nc(c(-c5cc(C)cc(C)c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C69H67N5O2/c1-7-9-11-13-15-49-19-26-55(27-20-49)74(56-28-21-50(22-29-56)16-14-12-10-8-2)68-64-37-35-62(72-64)66(53-41-45(3)39-46(4)42-53)60-33-31-58(70-60)57(30-23-51-17-24-52(25-18-51)69(75)76)59-32-34-61(71-59)67(63-36-38-65(68)73-63)54-43-47(5)40-48(6)44-54/h17-22,24-29,31-44,70,73H,7-16H2,1-6H3,(H,75,76)/b58-57-,59-57-,66-60-,66-62-,67-61-,67-63-,68-64+,68-65+ |
| InChIKey | ZTQZTGXOSJAPMA-IBNBEODISA-N |
| XLogP | 18.04 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.33 |
| LogP ≤ 5 | 18.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|