C42H23N3O6 — CID 132941108
4-[2-[7,12-bis[2-(4-carboxyphenyl)ethynyl]-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaen-2-yl]ethynyl]benzoic acid (PubChem CID 132941108) has the molecular formula C42H23N3O6 and a molecular weight of 665.66 g/mol. Its IUPAC name is 4-[2-[7,12-bis[2-(4-carboxyphenyl)ethynyl]-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaen-2-yl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[7,12-bis[2-(4-carboxyphenyl)ethynyl]-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaen-2-yl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 132941108 |
| Molecular Formula | C42H23N3O6 |
| Molecular Weight | 665.66 g/mol |
| Exact Mass | 665.16 |
| IUPAC Name | 4-[2-[7,12-bis[2-(4-carboxyphenyl)ethynyl]-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1(16),2,4,6,8,10,12,14-octaen-2-yl]ethynyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C#Cc2c3nc(c(C#Cc4ccc(C(=O)O)cc4)c4ccc([nH]4)c(C#Cc4ccc(C(=O)O)cc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C42H23N3O6/c46-40(47)28-10-1-25(2-11-28)7-16-31-34-19-21-36(43-34)32(17-8-26-3-12-29(13-4-26)41(48)49)38-23-24-39(45-38)33(37-22-20-35(31)44-37)18-9-27-5-14-30(15-6-27)42(50)51/h1-6,10-15,19-24,43-44H,(H,46,47)(H,48,49)(H,50,51)/b34-31-,35-31+,36-32-,37-33+,38-32-,39-33- |
| InChIKey | ILDIWNBVMINSFP-YBQOKCSFSA-N |
| XLogP | 6.95 |
| TPSA | 156.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|