C38H26N4O2 — CID 136902021
4-(5,15-diphenyl-22,23-dihydro-21H-corrin-10-yl)benzoic acid (PubChem CID 136902021) has the molecular formula C38H26N4O2 and a molecular weight of 570.65 g/mol. Its IUPAC name is 4-(5,15-diphenyl-22,23-dihydro-21H-corrin-10-yl)benzoic acid.
| Compound Name | 4-(5,15-diphenyl-22,23-dihydro-21H-corrin-10-yl)benzoic acid |
|---|---|
| PubChem CID | 136902021 |
| Molecular Formula | C38H26N4O2 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 4-(5,15-diphenyl-22,23-dihydro-21H-corrin-10-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3ccc([nH]3)c(-c3ccccc3)c3nc(c4ccc([nH]4)c(-c4ccccc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C38H26N4O2/c43-38(44)26-13-11-25(12-14-26)37-33-21-19-31(41-33)35(23-7-3-1-4-8-23)29-17-15-27(39-29)28-16-18-30(40-28)36(24-9-5-2-6-10-24)32-20-22-34(37)42-32/h1-22,39,41-42H,(H,43,44)/b28-27-,35-29-,35-31-,36-30-,36-32-,37-33-,37-34- |
| InChIKey | UVPSGTWVTNGKNR-BXDIYPIMSA-N |
| XLogP | 9.40 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |