C54H46N4O4 — CID 137211640
4-[10,20-bis(4-tert-butylphenyl)-15-(4-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 137211640) has the molecular formula C54H46N4O4 and a molecular weight of 814.99 g/mol. Its IUPAC name is 4-[10,20-bis(4-tert-butylphenyl)-15-(4-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,20-bis(4-tert-butylphenyl)-15-(4-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 137211640 |
| Molecular Formula | C54H46N4O4 |
| Molecular Weight | 814.99 g/mol |
| Exact Mass | 814.35 |
| IUPAC Name | 4-[10,20-bis(4-tert-butylphenyl)-15-(4-carboxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C54H46N4O4/c1-53(2,3)37-19-15-33(16-20-37)49-43-27-23-39(55-43)47(31-7-11-35(12-8-31)51(59)60)41-25-29-45(57-41)50(34-17-21-38(22-18-34)54(4,5)6)46-30-26-42(58-46)48(40-24-28-44(49)56-40)32-9-13-36(14-10-32)52(61)62/h7-30,55,58H,1-6H3,(H,59,60)(H,61,62)/b47-39-,47-41-,48-40-,48-42-,49-43-,49-44-,50-45-,50-46- |
| InChIKey | UDFNVTTVBKLMAT-CGBDAEPUSA-N |
| XLogP | 13.31 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.99 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |