C49H50N4 — CID 74788342
5,10,15-tris(4-tert-butylphenyl)-22,24-dihydro-21H-corrin (PubChem CID 74788342) has the molecular formula C49H50N4 and a molecular weight of 694.97 g/mol. Its IUPAC name is 5,10,15-tris(4-tert-butylphenyl)-22,24-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(4-tert-butylphenyl)-22,24-dihydro-21H-corrin |
|---|---|
| PubChem CID | 74788342 |
| Molecular Formula | C49H50N4 |
| Molecular Weight | 694.97 g/mol |
| Exact Mass | 694.40 |
| IUPAC Name | 5,10,15-tris(4-tert-butylphenyl)-22,24-dihydro-21H-corrin |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C(C)(C)C)cc4)c4ccc([nH]4)c4ccc([nH]4)c(-c4ccc(C(C)(C)C)cc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C49H50N4/c1-47(2,3)33-16-10-30(11-17-33)44-38-24-22-36(50-38)37-23-25-39(51-37)45(31-12-18-34(19-13-31)48(4,5)6)41-27-29-43(53-41)46(42-28-26-40(44)52-42)32-14-20-35(21-15-32)49(7,8)9/h10-29,50-52H,1-9H3/b37-36-,44-38-,44-40-,45-39-,45-41-,46-42-,46-43- |
| InChIKey | SHXXMVCVSAVCEH-WPXWEGTBSA-N |
| XLogP | 13.59 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.97 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |