C62H66N4 — CID 136773315
5,15-bis(3,5-ditert-butylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin (PubChem CID 136773315) has the molecular formula C62H66N4 and a molecular weight of 867.24 g/mol. Its IUPAC name is 5,15-bis(3,5-ditert-butylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(3,5-ditert-butylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136773315 |
| Molecular Formula | C62H66N4 |
| Molecular Weight | 867.24 g/mol |
| Exact Mass | 866.53 |
| IUPAC Name | 5,15-bis(3,5-ditert-butylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C62H66N4/c1-37-15-19-39(20-16-37)55-47-23-27-51(63-47)57(41-31-43(59(3,4)5)35-44(32-41)60(6,7)8)53-29-25-49(65-53)56(40-21-17-38(2)18-22-40)50-26-30-54(66-50)58(52-28-24-48(55)64-52)42-33-45(61(9,10)11)36-46(34-42)62(12,13)14/h15-36,63,66H,1-14H3/b55-47-,55-48-,56-49-,56-50-,57-51-,57-53-,58-52-,58-54- |
| InChIKey | JETCRZRUMWLWHY-LZRNDMPZSA-N |
| XLogP | 17.13 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.24 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |