C74H68N6 — CID 136812073
4-[4-[10-[4-(4-cyanophenyl)phenyl]-15,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]benzonitrile (PubChem CID 136812073) has the molecular formula C74H68N6 and a molecular weight of 1041.40 g/mol. Its IUPAC name is 4-[4-[10-[4-(4-cyanophenyl)phenyl]-15,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[10-[4-(4-cyanophenyl)phenyl]-15,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 136812073 |
| Molecular Formula | C74H68N6 |
| Molecular Weight | 1041.40 g/mol |
| Exact Mass | 1040.55 |
| IUPAC Name | 4-[4-[10-[4-(4-cyanophenyl)phenyl]-15,20-bis(3,5-ditert-butylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]benzonitrile |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([nH]4)c(-c4ccc(-c5ccc(C#N)cc5)cc4)c4nc(c(-c5ccc(-c6ccc(C#N)cc6)cc5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C74H68N6/c1-71(2,3)55-37-53(38-56(41-55)72(4,5)6)69-63-33-31-61(78-63)67(51-25-21-49(22-26-51)47-17-13-45(43-75)14-18-47)59-29-30-60(77-59)68(52-27-23-50(24-28-52)48-19-15-46(44-76)16-20-48)62-32-34-64(79-62)70(66-36-35-65(69)80-66)54-39-57(73(7,8)9)42-58(40-54)74(10,11)12/h13-42,78-79H,1-12H3/b67-59-,67-61-,68-60-,68-62-,69-63-,69-65-,70-64-,70-66- |
| InChIKey | XWLWQUIGSVMZIZ-ZZRUOVIGSA-N |
| XLogP | 19.59 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.40 |
| LogP ≤ 5 | 19.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |