C62H67BN6O2 — CID 135616881
5-[10,20-bis(3,5-ditert-butylphenyl)-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21,23-dihydroporphyrin-5-yl]benzene-1,3-dicarbonitrile (PubChem CID 135616881) has the molecular formula C62H67BN6O2 and a molecular weight of 939.07 g/mol. Its IUPAC name is 5-[10,20-bis(3,5-ditert-butylphenyl)-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21,23-dihydroporphyrin-5-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-[10,20-bis(3,5-ditert-butylphenyl)-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21,23-dihydroporphyrin-5-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 135616881 |
| Molecular Formula | C62H67BN6O2 |
| Molecular Weight | 939.07 g/mol |
| Exact Mass | 938.54 |
| IUPAC Name | 5-[10,20-bis(3,5-ditert-butylphenyl)-15-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21,23-dihydroporphyrin-5-yl]benzene-1,3-dicarbonitrile |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C#N)cc(C#N)c4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(B5OC(C)(C)C(C)(C)O5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C62H67BN6O2/c1-57(2,3)41-28-39(29-42(32-41)58(4,5)6)54-47-19-17-45(66-47)53(38-26-36(34-64)25-37(27-38)35-65)46-18-20-48(67-46)55(40-30-43(59(7,8)9)33-44(31-40)60(10,11)12)50-22-24-52(69-50)56(51-23-21-49(54)68-51)63-70-61(13,14)62(15,16)71-63/h17-33,66,69H,1-16H3/b53-45-,53-46-,54-47-,54-49-,55-48-,55-50-,56-51+,56-52+ |
| InChIKey | VFISDCYYBDJPDU-VUURASSBSA-N |
| XLogP | 14.89 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.07 |
| LogP ≤ 5 | 14.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|