C50H56B2N4O4 — CID 102395901
5,15-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin (PubChem CID 102395901) has the molecular formula C50H56B2N4O4 and a molecular weight of 798.65 g/mol. Its IUPAC name is 5,15-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 5,15-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 102395901 |
| Molecular Formula | C50H56B2N4O4 |
| Molecular Weight | 798.65 g/mol |
| Exact Mass | 798.45 |
| IUPAC Name | 5,15-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(B4OC(C)(C)C(C)(C)O4)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc([nH]5)c(B5OC(C)(C)C(C)(C)O5)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C50H56B2N4O4/c1-27-23-29(3)41(30(4)24-27)43-33-15-19-37(53-33)45(51-57-47(7,8)48(9,10)58-51)39-21-17-35(55-39)44(42-31(5)25-28(2)26-32(42)6)36-18-22-40(56-36)46(38-20-16-34(43)54-38)52-59-49(11,12)50(13,14)60-52/h15-26,53,55H,1-14H3/b43-33+,43-34+,44-35+,44-36+,45-37+,45-39+,46-38+,46-40+ |
| InChIKey | FUQQYHMFHUDHPS-QQEFJFKVSA-N |
| XLogP | 10.44 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.65 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|