C52H46N4 — CID 135490543
5,15-bis(2-methylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin (PubChem CID 135490543) has the molecular formula C52H46N4 and a molecular weight of 726.97 g/mol. Its IUPAC name is 5,15-bis(2-methylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(2-methylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135490543 |
| Molecular Formula | C52H46N4 |
| Molecular Weight | 726.97 g/mol |
| Exact Mass | 726.37 |
| IUPAC Name | 5,15-bis(2-methylphenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4ccccc4C)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(c(-c5ccccc5C)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C52H46N4/c1-29-25-33(5)47(34(6)26-29)51-43-21-17-39(53-43)49(37-15-11-9-13-31(37)3)41-19-23-45(55-41)52(48-35(7)27-30(2)28-36(48)8)46-24-20-42(56-46)50(40-18-22-44(51)54-40)38-16-12-10-14-32(38)4/h9-28,53,56H,1-8H3/b49-39-,49-41-,50-40-,50-42-,51-43+,51-44+,52-45+,52-46+ |
| InChIKey | PQULQCQHVKPIQI-ZABGCZTGSA-N |
| XLogP | 13.79 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.97 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |