C50H38F4N4 — CID 11050991
10,20-bis(2,6-difluorophenyl)-5,15-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin (PubChem CID 11050991) has the molecular formula C50H38F4N4 and a molecular weight of 770.87 g/mol. Its IUPAC name is 10,20-bis(2,6-difluorophenyl)-5,15-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 10,20-bis(2,6-difluorophenyl)-5,15-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11050991 |
| Molecular Formula | C50H38F4N4 |
| Molecular Weight | 770.87 g/mol |
| Exact Mass | 770.30 |
| IUPAC Name | 10,20-bis(2,6-difluorophenyl)-5,15-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(F)cccc4F)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4c(F)cccc4F)c4nc2C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C50H38F4N4/c1-25-21-27(3)43(28(4)22-25)47-35-13-17-39(55-35)49(45-31(51)9-7-10-32(45)52)41-19-15-37(57-41)48(44-29(5)23-26(2)24-30(44)6)38-16-20-42(58-38)50(40-18-14-36(47)56-40)46-33(53)11-8-12-34(46)54/h7-24,55-56H,1-6H3/b47-35+,47-36+,48-37+,48-38+,49-39+,49-41+,50-40+,50-42+ |
| InChIKey | JYGFIFKBXBUFLP-BKCBNECLSA-N |
| XLogP | 13.73 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.87 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |