C56H42N8 — CID 10771772
3,5-dimethyl-4-[10,15,20-tris(4-cyano-2,6-dimethylphenyl)-21,24-dihydroporphyrin-5-yl]benzonitrile (PubChem CID 10771772) has the molecular formula C56H42N8 and a molecular weight of 827.01 g/mol. Its IUPAC name is 3,5-dimethyl-4-[10,15,20-tris(4-cyano-2,6-dimethylphenyl)-21,24-dihydroporphyrin-5-yl]benzonitrile.
| Compound Name | 3,5-dimethyl-4-[10,15,20-tris(4-cyano-2,6-dimethylphenyl)-21,24-dihydroporphyrin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 10771772 |
| Molecular Formula | C56H42N8 |
| Molecular Weight | 827.01 g/mol |
| Exact Mass | 826.35 |
| IUPAC Name | 3,5-dimethyl-4-[10,15,20-tris(4-cyano-2,6-dimethylphenyl)-21,24-dihydroporphyrin-5-yl]benzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1-c1c2nc(c(-c3c(C)cc(C#N)cc3C)c3ccc([nH]3)c(-c3c(C)cc(C#N)cc3C)c3ccc([nH]3)c(-c3c(C)cc(C#N)cc3C)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C56H42N8/c1-29-17-37(25-57)18-30(2)49(29)53-41-9-11-43(61-41)54(50-31(3)19-38(26-58)20-32(50)4)45-13-15-47(63-45)56(52-35(7)23-40(28-60)24-36(52)8)48-16-14-46(64-48)55(44-12-10-42(53)62-44)51-33(5)21-39(27-59)22-34(51)6/h9-24,61-62H,1-8H3/b53-41+,53-42+,54-43+,54-45+,55-44+,55-46+,56-47+,56-48+ |
| InChIKey | KXZXUVYPPRXFQE-RNWYWIMESA-N |
| XLogP | 13.28 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.01 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |