C60H51N5 — CID 137254083
5-[4-(2-pyridin-4-ylethynyl)phenyl]-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin (PubChem CID 137254083) has the molecular formula C60H51N5 and a molecular weight of 842.10 g/mol. Its IUPAC name is 5-[4-(2-pyridin-4-ylethynyl)phenyl]-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-[4-(2-pyridin-4-ylethynyl)phenyl]-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137254083 |
| Molecular Formula | C60H51N5 |
| Molecular Weight | 842.10 g/mol |
| Exact Mass | 841.41 |
| IUPAC Name | 5-[4-(2-pyridin-4-ylethynyl)phenyl]-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(c(-c5ccc(C#Cc6ccncc6)cc5)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C60H51N5/c1-34-28-37(4)54(38(5)29-34)58-48-18-16-46(62-48)57(45-14-12-43(13-15-45)10-11-44-24-26-61-27-25-44)47-17-19-49(63-47)59(55-39(6)30-35(2)31-40(55)7)51-21-23-53(65-51)60(52-22-20-50(58)64-52)56-41(8)32-36(3)33-42(56)9/h12-33,62,65H,1-9H3/b57-46-,57-47-,58-48+,58-50+,59-49+,59-51+,60-52+,60-53+ |
| InChIKey | QYBQNZFIFRKPKI-PLRRWWODSA-N |
| XLogP | 14.89 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.10 |
| LogP ≤ 5 | 14.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|