C57H48N4 — CID 11029253
5-(3,5-diethynylphenyl)-10,15,20-tris(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin (PubChem CID 11029253) has the molecular formula C57H48N4 and a molecular weight of 789.04 g/mol. Its IUPAC name is 5-(3,5-diethynylphenyl)-10,15,20-tris(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 5-(3,5-diethynylphenyl)-10,15,20-tris(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11029253 |
| Molecular Formula | C57H48N4 |
| Molecular Weight | 789.04 g/mol |
| Exact Mass | 788.39 |
| IUPAC Name | 5-(3,5-diethynylphenyl)-10,15,20-tris(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
| SMILES | C#Cc1cc(C#C)cc(-c2c3ccc([nH]3)c(-c3c(C)cc(C)cc3C)c3nc(c(-c4c(C)cc(C)cc4C)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C57H48N4/c1-12-40-28-41(13-2)30-42(29-40)54-43-14-16-45(58-43)55(51-34(6)22-31(3)23-35(51)7)47-18-20-49(60-47)57(53-38(10)26-33(5)27-39(53)11)50-21-19-48(61-50)56(46-17-15-44(54)59-46)52-36(8)24-32(4)25-37(52)9/h1-2,14-30,58-59H,3-11H3/b54-43-,54-44-,55-45+,55-47+,56-46+,56-48+,57-49+,57-50+ |
| InChIKey | JGQGNNLGKHNXII-PBZHUTIISA-N |
| XLogP | 14.06 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.04 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|