C50H42N4 — CID 177402176
11,12-diphenyl-6,17-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrazapentacyclo[16.2.1.12,5.17,10.113,16]tetracosa-1,3,5,7(23),8,10,12,14,16,18(21),19-undecaene (PubChem CID 177402176) has the molecular formula C50H42N4 and a molecular weight of 698.91 g/mol. Its IUPAC name is 11,12-diphenyl-6,17-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrazapentacyclo[16.2.1.12,5.17,10.113,16]tetracosa-1,3,5,7(23),8,10,12,14,16,18(21),19-undecaene.
| Compound Name | 11,12-diphenyl-6,17-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrazapentacyclo[16.2.1.12,5.17,10.113,16]tetracosa-1,3,5,7(23),8,10,12,14,16,18(21),19-undecaene |
|---|---|
| PubChem CID | 177402176 |
| Molecular Formula | C50H42N4 |
| Molecular Weight | 698.91 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | 11,12-diphenyl-6,17-bis(2,4,6-trimethylphenyl)-21,22,23,24-tetrazapentacyclo[16.2.1.12,5.17,10.113,16]tetracosa-1,3,5,7(23),8,10,12,14,16,18(21),19-undecaene |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4ccccc4)c(-c4ccccc4)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C50H42N4/c1-29-25-31(3)45(32(4)26-29)49-41-19-17-37(51-41)38-18-20-42(52-38)50(46-33(5)27-30(2)28-34(46)6)44-24-22-40(54-44)48(36-15-11-8-12-16-36)47(35-13-9-7-10-14-35)39-21-23-43(49)53-39/h7-28,51,54H,1-6H3/b38-37+,47-39-,48-40-,48-47-,49-41+,49-43+,50-42-,50-44+ |
| InChIKey | GRVNMJZPMULTSC-QJZNXSDWSA-N |
| XLogP | 13.17 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.91 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |