C43H38N4O — CID 11814204
3-[5,15-bis(2,4,6-trimethylphenyl)-22,24-dihydro-21H-corrin-10-yl]phenol (PubChem CID 11814204) has the molecular formula C43H38N4O and a molecular weight of 626.80 g/mol. Its IUPAC name is 3-[5,15-bis(2,4,6-trimethylphenyl)-22,24-dihydro-21H-corrin-10-yl]phenol.
| Compound Name | 3-[5,15-bis(2,4,6-trimethylphenyl)-22,24-dihydro-21H-corrin-10-yl]phenol |
|---|---|
| PubChem CID | 11814204 |
| Molecular Formula | C43H38N4O |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | 3-[5,15-bis(2,4,6-trimethylphenyl)-22,24-dihydro-21H-corrin-10-yl]phenol |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c4ccc2[nH]4)C=C3)c(C)c1 |
| InChI | InChI=1S/C43H38N4O/c1-23-18-25(3)39(26(4)19-23)42-35-12-10-31(44-35)32-11-13-36(45-32)43(40-27(5)20-24(2)21-28(40)6)38-17-15-34(47-38)41(33-14-16-37(42)46-33)29-8-7-9-30(48)22-29/h7-22,44-46,48H,1-6H3/b32-31-,41-33-,41-34-,42-35+,42-37+,43-36+,43-38+ |
| InChIKey | ZPJQENQHYBUJQJ-PYKUCHOJSA-N |
| XLogP | 11.25 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |