C38H26N4O3 — CID 141240243
3-[10,15-bis(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol (PubChem CID 141240243) has the molecular formula C38H26N4O3 and a molecular weight of 586.65 g/mol. Its IUPAC name is 3-[10,15-bis(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol.
| Compound Name | 3-[10,15-bis(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 141240243 |
| Molecular Formula | C38H26N4O3 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 3-[10,15-bis(3-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]phenol |
| SMILES | Oc1cccc(-c2c3nc(c(-c4cccc(O)c4)c4ccc([nH]4)c(-c4cccc(O)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C38H26N4O3/c43-27-7-1-4-22(18-27)36-30-12-10-25(39-30)21-26-11-13-31(40-26)37(23-5-2-8-28(44)19-23)33-15-17-35(42-33)38(34-16-14-32(36)41-34)24-6-3-9-29(45)20-24/h1-21,39,42-45H/b25-21-,26-21-,36-30-,36-32-,37-31-,37-33-,38-34-,38-35- |
| InChIKey | AMLZCCNUWFWANA-JYKFUDPBSA-N |
| XLogP | 8.77 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |