C50H32N4 — CID 136749947
5,10,15-trinaphthalen-2-yl-21,23-dihydroporphyrin (PubChem CID 136749947) has the molecular formula C50H32N4 and a molecular weight of 688.83 g/mol. Its IUPAC name is 5,10,15-trinaphthalen-2-yl-21,23-dihydroporphyrin.
| Compound Name | 5,10,15-trinaphthalen-2-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136749947 |
| Molecular Formula | C50H32N4 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | 5,10,15-trinaphthalen-2-yl-21,23-dihydroporphyrin |
| SMILES | C1=Cc2nc1cc1ccc([nH]1)c(-c1ccc3ccccc3c1)c1nc(c(-c3ccc4ccccc4c3)c3ccc([nH]3)c2-c2ccc3ccccc3c2)C=C1 |
| InChI | InChI=1S/C50H32N4/c1-4-10-34-27-37(16-13-31(34)7-1)48-42-21-19-40(51-42)30-41-20-22-43(52-41)49(38-17-14-32-8-2-5-11-35(32)28-38)45-24-26-47(54-45)50(46-25-23-44(48)53-46)39-18-15-33-9-3-6-12-36(33)29-39/h1-30,51,54H/b40-30-,41-30-,48-42-,48-44-,49-43-,49-45-,50-46-,50-47- |
| InChIKey | NLCPKVHPSRZHFA-UGEFUXDSSA-N |
| XLogP | 13.12 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |