C32H23N5 — CID 136859118
10,20-diphenyl-21,23-dihydroporphyrin-5-amine (PubChem CID 136859118) has the molecular formula C32H23N5 and a molecular weight of 477.57 g/mol. Its IUPAC name is 10,20-diphenyl-21,23-dihydroporphyrin-5-amine.
| Compound Name | 10,20-diphenyl-21,23-dihydroporphyrin-5-amine |
|---|---|
| PubChem CID | 136859118 |
| Molecular Formula | C32H23N5 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 10,20-diphenyl-21,23-dihydroporphyrin-5-amine |
| SMILES | Nc1c2nc(c(-c3ccccc3)c3ccc(cc4nc(c(-c5ccccc5)c5ccc1[nH]5)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C32H23N5/c33-32-28-17-15-26(36-28)30(20-7-3-1-4-8-20)24-13-11-22(34-24)19-23-12-14-25(35-23)31(21-9-5-2-6-10-21)27-16-18-29(32)37-27/h1-19,34,37H,33H2/b22-19-,23-19-,30-24-,30-26-,31-25-,31-27-,32-28+,32-29+ |
| InChIKey | IHCRPRVQKABDPY-BRZPQLSBSA-N |
| XLogP | 7.57 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |