C37H30N4Si — CID 173327875
2-(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)ethynyl-trimethylsilane (PubChem CID 173327875) has the molecular formula C37H30N4Si and a molecular weight of 558.76 g/mol. Its IUPAC name is 2-(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 173327875 |
| Molecular Formula | C37H30N4Si |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 2-(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1c2nc(c(-c3ccccc3)c3ccc(cc4nc(c(-c5ccccc5)c5ccc1[nH]5)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C37H30N4Si/c1-42(2,3)23-22-29-30-18-20-34(40-30)36(25-10-6-4-7-11-25)32-16-14-27(38-32)24-28-15-17-33(39-28)37(26-12-8-5-9-13-26)35-21-19-31(29)41-35/h4-21,24,38,41H,1-3H3/b27-24-,28-24-,30-29-,31-29-,36-32-,36-34-,37-33-,37-35- |
| InChIKey | ACRPNJMGTSMXPX-MFQFVVPWSA-N |
| XLogP | 9.22 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|