C50H52N4Sn — CID 135873665
tributyl-[3-(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)phenyl]stannane (PubChem CID 135873665) has the molecular formula C50H52N4Sn and a molecular weight of 827.71 g/mol. Its IUPAC name is tributyl-[3-(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)phenyl]stannane.
| Compound Name | tributyl-[3-(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)phenyl]stannane |
|---|---|
| PubChem CID | 135873665 |
| Molecular Formula | C50H52N4Sn |
| Molecular Weight | 827.71 g/mol |
| Exact Mass | 828.32 |
| IUPAC Name | tributyl-[3-(10,20-diphenyl-21,23-dihydroporphyrin-5-yl)phenyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(-c2c3nc(c(-c4ccccc4)c4ccc(cc5nc(c(-c6ccccc6)c6ccc2[nH]6)C=C5)[nH]4)C=C3)c1 |
| InChI | InChI=1S/C38H25N4.3C4H9.Sn/c1-4-10-25(11-5-1)36-30-18-16-28(39-30)24-29-17-19-31(40-29)37(26-12-6-2-7-13-26)33-21-23-35(42-33)38(27-14-8-3-9-15-27)34-22-20-32(36)41-34;3*1-3-4-2;/h1-8,10-24,39,42H;3*1,3-4H2,2H3;/b28-24-,29-24-,36-30-,36-32-,37-31-,37-33-,38-34-,38-35-;;;; |
| InChIKey | GUFMDHBGPWMOJU-KQPJUTMCSA-N |
| XLogP | 13.71 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.71 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |