C38H28N6 — CID 141332730
2-[10-(2-aminophenyl)-15-phenyl-21,23-dihydroporphyrin-5-yl]aniline (PubChem CID 141332730) has the molecular formula C38H28N6 and a molecular weight of 568.68 g/mol. Its IUPAC name is 2-[10-(2-aminophenyl)-15-phenyl-21,23-dihydroporphyrin-5-yl]aniline.
| Compound Name | 2-[10-(2-aminophenyl)-15-phenyl-21,23-dihydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 141332730 |
| Molecular Formula | C38H28N6 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 2-[10-(2-aminophenyl)-15-phenyl-21,23-dihydroporphyrin-5-yl]aniline |
| SMILES | Nc1ccccc1-c1c2nc(c(-c3ccccc3N)c3ccc([nH]3)c(-c3ccccc3)c3nc(cc4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C38H28N6/c39-28-12-6-4-10-26(28)37-32-17-15-25(42-32)22-24-14-16-30(41-24)36(23-8-2-1-3-9-23)31-18-19-34(43-31)38(35-21-20-33(37)44-35)27-11-5-7-13-29(27)40/h1-22,42-43H,39-40H2/b24-22-,25-22-,36-30-,36-31-,37-32-,37-33-,38-34-,38-35- |
| InChIKey | RDLNIDBIGSPFNB-PXIOSUESSA-N |
| XLogP | 8.82 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|