C44H32N6 — CID 176998905
4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzene-1,3-diamine (PubChem CID 176998905) has the molecular formula C44H32N6 and a molecular weight of 644.78 g/mol. Its IUPAC name is 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzene-1,3-diamine.
| Compound Name | 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 176998905 |
| Molecular Formula | C44H32N6 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | 4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzene-1,3-diamine |
| SMILES | Nc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)c(N)c1 |
| InChI | InChI=1S/C44H32N6/c45-30-16-17-31(32(46)26-30)44-39-24-22-37(49-39)42(28-12-6-2-7-13-28)35-20-18-33(47-35)41(27-10-4-1-5-11-27)34-19-21-36(48-34)43(29-14-8-3-9-15-29)38-23-25-40(44)50-38/h1-26,47,50H,45-46H2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | HGCVHGRLRQMCJB-LWQDQPMZSA-N |
| XLogP | 10.49 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|