C44H32N6O2 — CID 135540951
3-[[15-(3-aminophenoxy)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]oxy]aniline (PubChem CID 135540951) has the molecular formula C44H32N6O2 and a molecular weight of 676.78 g/mol. Its IUPAC name is 3-[[15-(3-aminophenoxy)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]oxy]aniline.
| Compound Name | 3-[[15-(3-aminophenoxy)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]oxy]aniline |
|---|---|
| PubChem CID | 135540951 |
| Molecular Formula | C44H32N6O2 |
| Molecular Weight | 676.78 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 3-[[15-(3-aminophenoxy)-10,20-diphenyl-21,23-dihydroporphyrin-5-yl]oxy]aniline |
| SMILES | Nc1cccc(Oc2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(Oc4cccc(N)c4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C44H32N6O2/c45-29-13-7-15-31(25-29)51-43-37-21-17-33(47-37)41(27-9-3-1-4-10-27)34-18-22-38(48-34)44(52-32-16-8-14-30(46)26-32)40-24-20-36(50-40)42(28-11-5-2-6-12-28)35-19-23-39(43)49-35/h1-26,47,50H,45-46H2/b41-33-,41-34-,42-35-,42-36-,43-37+,43-39+,44-38+,44-40+ |
| InChIKey | KQWIBINFTPQSLT-DZOIGKAZSA-N |
| XLogP | 10.74 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.78 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|