C38H27N5 — CID 152611661
3-(15,20-diphenyl-21,23-dihydroporphyrin-2-yl)aniline (PubChem CID 152611661) has the molecular formula C38H27N5 and a molecular weight of 553.67 g/mol. Its IUPAC name is 3-(15,20-diphenyl-21,23-dihydroporphyrin-2-yl)aniline.
| Compound Name | 3-(15,20-diphenyl-21,23-dihydroporphyrin-2-yl)aniline |
|---|---|
| PubChem CID | 152611661 |
| Molecular Formula | C38H27N5 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 3-(15,20-diphenyl-21,23-dihydroporphyrin-2-yl)aniline |
| SMILES | Nc1cccc(-c2cc3cc4nc(cc5ccc([nH]5)c(-c5ccccc5)c5nc(c(-c6ccccc6)c2[nH]3)C=C5)C=C4)c1 |
| InChI | InChI=1S/C38H27N5/c39-27-13-7-12-26(20-27)32-23-31-22-29-15-14-28(40-29)21-30-16-17-33(41-30)36(24-8-3-1-4-9-24)34-18-19-35(43-34)37(38(32)42-31)25-10-5-2-6-11-25/h1-23,41-42H,39H2/b28-21-,29-22-,30-21-,31-22-,36-33-,36-34-,37-35-,38-37- |
| InChIKey | YZQMVKIZDPZJSE-DOFDRCBOSA-N |
| XLogP | 9.24 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|