C32H23N5 — CID 141332732
2-(10-phenyl-21,23-dihydroporphyrin-5-yl)aniline (PubChem CID 141332732) has the molecular formula C32H23N5 and a molecular weight of 477.57 g/mol. Its IUPAC name is 2-(10-phenyl-21,23-dihydroporphyrin-5-yl)aniline.
| Compound Name | 2-(10-phenyl-21,23-dihydroporphyrin-5-yl)aniline |
|---|---|
| PubChem CID | 141332732 |
| Molecular Formula | C32H23N5 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-(10-phenyl-21,23-dihydroporphyrin-5-yl)aniline |
| SMILES | Nc1ccccc1-c1c2nc(c(-c3ccccc3)c3ccc(cc4nc(cc5ccc1[nH]5)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C32H23N5/c33-26-9-5-4-8-25(26)32-29-15-13-24(36-29)19-22-11-10-21(34-22)18-23-12-14-27(35-23)31(20-6-2-1-3-7-20)28-16-17-30(32)37-28/h1-19,35-36H,33H2/b21-18-,22-19-,23-18-,24-19-,31-27-,31-28-,32-29-,32-30- |
| InChIKey | LFXCBKJLHWQADT-UKZZUVFUSA-N |
| XLogP | 7.57 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|