C33H22N4O — CID 135415239
10,20-diphenyl-21,23-dihydroporphyrin-5-carbaldehyde (PubChem CID 135415239) has the molecular formula C33H22N4O and a molecular weight of 490.57 g/mol. Its IUPAC name is 10,20-diphenyl-21,23-dihydroporphyrin-5-carbaldehyde.
| Compound Name | 10,20-diphenyl-21,23-dihydroporphyrin-5-carbaldehyde |
|---|---|
| PubChem CID | 135415239 |
| Molecular Formula | C33H22N4O |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 10,20-diphenyl-21,23-dihydroporphyrin-5-carbaldehyde |
| SMILES | O=Cc1c2nc(c(-c3ccccc3)c3ccc(cc4nc(c(-c5ccccc5)c5ccc1[nH]5)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C33H22N4O/c38-20-25-26-15-17-30(36-26)32(21-7-3-1-4-8-21)28-13-11-23(34-28)19-24-12-14-29(35-24)33(22-9-5-2-6-10-22)31-18-16-27(25)37-31/h1-20,34,37H/b23-19-,24-19-,26-25-,27-25-,32-28-,32-30-,33-29-,33-31- |
| InChIKey | GVZCFIYVNGIZBC-HHPYPRDHSA-N |
| XLogP | 7.80 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|