C34H24N4 — CID 135513055
10-(2,2-dideuterioethenyl)-5,15-diphenyl-21,23-dihydroporphyrin (PubChem CID 135513055) has the molecular formula C34H24N4 and a molecular weight of 490.61 g/mol. Its IUPAC name is 10-(2,2-dideuterioethenyl)-5,15-diphenyl-21,23-dihydroporphyrin.
| Compound Name | 10-(2,2-dideuterioethenyl)-5,15-diphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135513055 |
| Molecular Formula | C34H24N4 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 10-(2,2-dideuterioethenyl)-5,15-diphenyl-21,23-dihydroporphyrin |
| SMILES | [2H]C([2H])=Cc1c2nc(c(-c3ccccc3)c3ccc(cc4nc(c(-c5ccccc5)c5ccc1[nH]5)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C34H24N4/c1-2-26-27-17-19-31(37-27)33(22-9-5-3-6-10-22)29-15-13-24(35-29)21-25-14-16-30(36-25)34(23-11-7-4-8-12-23)32-20-18-28(26)38-32/h2-21,35,38H,1H2/b24-21-,25-21-,27-26-,28-26-,33-29-,33-31-,34-30-,34-32-/i1D2 |
| InChIKey | IOTIPGWVKGKZFE-RERPVHHXSA-N |
| XLogP | 8.63 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |