C34H23BrN4 — CID 10769334
15-[(E)-2-bromoethenyl]-10,20-diphenyl-21,22-dihydroporphyrin (PubChem CID 10769334) has the molecular formula C34H23BrN4 and a molecular weight of 567.49 g/mol. Its IUPAC name is 15-[(E)-2-bromoethenyl]-10,20-diphenyl-21,22-dihydroporphyrin.
| Compound Name | 15-[(E)-2-bromoethenyl]-10,20-diphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10769334 |
| Molecular Formula | C34H23BrN4 |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 15-[(E)-2-bromoethenyl]-10,20-diphenyl-21,22-dihydroporphyrin |
| SMILES | Br/C=C/c1c2nc(c(-c3ccccc3)c3ccc(cc4ccc([nH]4)c(-c4ccccc4)c4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C34H23BrN4/c35-20-19-26-27-15-17-31(38-27)33(22-7-3-1-4-8-22)29-13-11-24(36-29)21-25-12-14-30(37-25)34(23-9-5-2-6-10-23)32-18-16-28(26)39-32/h1-21,36-37H/b20-19+,24-21-,25-21-,27-26-,28-26-,33-29-,33-31-,34-30-,34-32- |
| InChIKey | XRWHTCRFONTDEC-AJZNNHEWSA-N |
| XLogP | 9.36 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |