C26H16ClFN4 — CID 70656299
15-chloro-10-fluoro-20-phenyl-21,22-dihydroporphyrin (PubChem CID 70656299) has the molecular formula C26H16ClFN4 and a molecular weight of 438.89 g/mol. Its IUPAC name is 15-chloro-10-fluoro-20-phenyl-21,22-dihydroporphyrin.
| Compound Name | 15-chloro-10-fluoro-20-phenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 70656299 |
| Molecular Formula | C26H16ClFN4 |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 15-chloro-10-fluoro-20-phenyl-21,22-dihydroporphyrin |
| SMILES | Fc1c2nc(c(Cl)c3nc(c(-c4ccccc4)c4ccc(cc5ccc1[nH]5)[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C26H16ClFN4/c27-25-20-11-10-19(31-20)24(15-4-2-1-3-5-15)18-8-6-16(29-18)14-17-7-9-22(30-17)26(28)23-13-12-21(25)32-23/h1-14,29-30H/b16-14-,17-14-,24-18-,24-19-,25-20+,25-21+,26-22+,26-23+ |
| InChIKey | CVYOBZPTYWMWNW-JMLOYAHWSA-N |
| XLogP | 7.12 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |