C40H38N4S — CID 11433445
15-octylsulfanyl-10,20-diphenyl-21,22-dihydroporphyrin (PubChem CID 11433445) has the molecular formula C40H38N4S and a molecular weight of 606.84 g/mol. Its IUPAC name is 15-octylsulfanyl-10,20-diphenyl-21,22-dihydroporphyrin.
| Compound Name | 15-octylsulfanyl-10,20-diphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 11433445 |
| Molecular Formula | C40H38N4S |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 15-octylsulfanyl-10,20-diphenyl-21,22-dihydroporphyrin |
| SMILES | CCCCCCCCSc1c2nc(c(-c3ccccc3)c3ccc(cc4ccc([nH]4)c(-c4ccccc4)c4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C40H38N4S/c1-2-3-4-5-6-13-26-45-40-36-24-22-34(43-36)38(28-14-9-7-10-15-28)32-20-18-30(41-32)27-31-19-21-33(42-31)39(29-16-11-8-12-17-29)35-23-25-37(40)44-35/h7-12,14-25,27,41-42H,2-6,13,26H2,1H3/b30-27-,31-27-,38-32-,38-34-,39-33-,39-35-,40-36+,40-37+ |
| InChIKey | ITGHEFUFYLHHPF-LLVDGWFCSA-N |
| XLogP | 11.44 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|