C39H28N4O — CID 10603098
15-(4-methoxyphenyl)-10,20-diphenyl-21,22-dihydroporphyrin (PubChem CID 10603098) has the molecular formula C39H28N4O and a molecular weight of 568.68 g/mol. Its IUPAC name is 15-(4-methoxyphenyl)-10,20-diphenyl-21,22-dihydroporphyrin.
| Compound Name | 15-(4-methoxyphenyl)-10,20-diphenyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10603098 |
| Molecular Formula | C39H28N4O |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 15-(4-methoxyphenyl)-10,20-diphenyl-21,22-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc(cc5ccc([nH]5)c(-c5ccccc5)c5nc2C=C5)[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C39H28N4O/c1-44-30-16-12-27(13-17-30)39-35-22-20-33(42-35)37(25-8-4-2-5-9-25)31-18-14-28(40-31)24-29-15-19-32(41-29)38(26-10-6-3-7-11-26)34-21-23-36(39)43-34/h2-24,40-41H,1H3/b28-24-,29-24-,37-31-,37-33-,38-32-,38-34-,39-35-,39-36- |
| InChIKey | JUGRYEAEXOEZMH-VDFCWUMKSA-N |
| XLogP | 9.67 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |