C48H38N4O — CID 135778239
5-(4-methoxyphenyl)-10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin (PubChem CID 135778239) has the molecular formula C48H38N4O and a molecular weight of 686.86 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-(4-methoxyphenyl)-10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135778239 |
| Molecular Formula | C48H38N4O |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.30 |
| IUPAC Name | 5-(4-methoxyphenyl)-10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H38N4O/c1-29-5-11-32(12-6-29)45-37-21-23-39(49-37)46(33-13-7-30(2)8-14-33)41-25-27-43(51-41)48(35-17-19-36(53-4)20-18-35)44-28-26-42(52-44)47(40-24-22-38(45)50-40)34-15-9-31(3)10-16-34/h5-28,49,52H,1-4H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | ZHBHTSGGDUYOJG-PJEPRTEXSA-N |
| XLogP | 12.26 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |