C46H32N6O6 — CID 135496782
5,15-bis(4-methoxyphenyl)-10,20-bis(4-nitrophenyl)-21,23-dihydroporphyrin (PubChem CID 135496782) has the molecular formula C46H32N6O6 and a molecular weight of 764.80 g/mol. Its IUPAC name is 5,15-bis(4-methoxyphenyl)-10,20-bis(4-nitrophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(4-methoxyphenyl)-10,20-bis(4-nitrophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135496782 |
| Molecular Formula | C46H32N6O6 |
| Molecular Weight | 764.80 g/mol |
| Exact Mass | 764.24 |
| IUPAC Name | 5,15-bis(4-methoxyphenyl)-10,20-bis(4-nitrophenyl)-21,23-dihydroporphyrin |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc([N+](=O)[O-])cc4)c4ccc([nH]4)c(-c4ccc(OC)cc4)c4nc(c(-c5ccc([N+](=O)[O-])cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H32N6O6/c1-57-33-15-7-29(8-16-33)45-39-23-19-35(47-39)43(27-3-11-31(12-4-27)51(53)54)37-21-25-41(49-37)46(30-9-17-34(58-2)18-10-30)42-26-22-38(50-42)44(36-20-24-40(45)48-36)28-5-13-32(14-6-28)52(55)56/h3-26,47,50H,1-2H3/b43-35-,43-37-,44-36-,44-38-,45-39-,45-40-,46-41-,46-42- |
| InChIKey | PACKSCWCXDIYOK-IWLVSUONSA-N |
| XLogP | 11.16 |
| TPSA | 162.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.80 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|